C19H19N3O2 — CID 20704834
6-oxo-N-(1,10-phenanthrolin-5-yl)heptanamide (PubChem CID 20704834) has the molecular formula C19H19N3O2 and a molecular weight of 321.38 g/mol. Its IUPAC name is 6-oxo-N-(1,10-phenanthrolin-5-yl)heptanamide.
| Compound Name | 6-oxo-N-(1,10-phenanthrolin-5-yl)heptanamide |
|---|---|
| PubChem CID | 20704834 |
| Molecular Formula | C19H19N3O2 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | 6-oxo-N-(1,10-phenanthrolin-5-yl)heptanamide |
| SMILES | CC(=O)CCCCC(=O)Nc1cc2cccnc2c2ncccc12 |
| InChI | InChI=1S/C19H19N3O2/c1-13(23)6-2-3-9-17(24)22-16-12-14-7-4-10-20-18(14)19-15(16)8-5-11-21-19/h4-5,7-8,10-12H,2-3,6,9H2,1H3,(H,22,24) |
| InChIKey | QZQBEJDNKJCWAG-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|