10-oxo-10-(1,10-phenanthrolin-5-ylamino)decanoic acid

C22H25N3O3 — CID 68544848

IUPAC10-oxo-10-(1,10-phenanthrolin-5-ylamino)decanoic acid
SMILESO=C(O)CCCCCCCCC(=O)Nc1cc2cccnc2c2ncccc12
InChIInChI=1S/C22H25N3O3/c26-19(11-5-3-1-2-4-6-12-20(27)28)25-18-15-16-9-7-13-23-21(16)22-17(18)10-8-14-24-22/h7-10,13-15H,1-6,11-12H2,(H,25,26)(H,27,28)
InChIKeyBNQOOSRSKCCVGM-UHFFFAOYSA-N
MW379.46 g/mol
LogP4.93
Rot. Bonds10

About 10-oxo-10-(1,10-phenanthrolin-5-ylamino)decanoic acid

10-oxo-10-(1,10-phenanthrolin-5-ylamino)decanoic acid (PubChem CID 68544848) has the molecular formula C22H25N3O3 and a molecular weight of 379.46 g/mol. Its IUPAC name is 10-oxo-10-(1,10-phenanthrolin-5-ylamino)decanoic acid.

Molecular Properties

Compound Name10-oxo-10-(1,10-phenanthrolin-5-ylamino)decanoic acid
PubChem CID68544848
Molecular FormulaC22H25N3O3
Molecular Weight379.46 g/mol
Exact Mass379.19
IUPAC Name10-oxo-10-(1,10-phenanthrolin-5-ylamino)decanoic acid
SMILESO=C(O)CCCCCCCCC(=O)Nc1cc2cccnc2c2ncccc12
InChIInChI=1S/C22H25N3O3/c26-19(11-5-3-1-2-4-6-12-20(27)28)25-18-15-16-9-7-13-23-21(16)22-17(18)10-8-14-24-22/h7-10,13-15H,1-6,11-12H2,(H,25,26)(H,27,28)
InChIKeyBNQOOSRSKCCVGM-UHFFFAOYSA-N
XLogP4.93
TPSA92.18 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds10
Heavy Atoms28
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500379.46
LogP ≤ 54.93
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}

Analyze 10-oxo-10-(1,10-phenanthrolin-5-ylamino)decanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 10-oxo-10-(1,10-phenanthrolin-5-ylamino)decanoic acid?
The IUPAC name of 10-oxo-10-(1,10-phenanthrolin-5-ylamino)decanoic acid (CID 68544848) is 10-oxo-10-(1,10-phenanthrolin-5-ylamino)decanoic acid.
What is the SMILES notation for 10-oxo-10-(1,10-phenanthrolin-5-ylamino)decanoic acid?
The canonical SMILES for 10-oxo-10-(1,10-phenanthrolin-5-ylamino)decanoic acid is O=C(O)CCCCCCCCC(=O)Nc1cc2cccnc2c2ncccc12.
What is the InChIKey of 10-oxo-10-(1,10-phenanthrolin-5-ylamino)decanoic acid?
The InChIKey is BNQOOSRSKCCVGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H25N3O3/c26-19(11-5-3-1-2-4-6-12-20(27)28)25-18-15-16-9-7-13-23-21(16)22-17(18)10-8-14-24-22/h7-10,13-15H,1-6,11-12H2,(H,25,26)(H,27,28).
What are the key properties of 10-oxo-10-(1,10-phenanthrolin-5-ylamino)decanoic acid?
10-oxo-10-(1,10-phenanthrolin-5-ylamino)decanoic acid has a molecular weight of 379.46 g/mol, XLogP of 4.93, 10 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 10-oxo-10-(1,10-phenanthrolin-5-ylamino)decanoic acid is sourced from PubChem (CID 68544848), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).