C22H25N3O3 — CID 68544848
10-oxo-10-(1,10-phenanthrolin-5-ylamino)decanoic acid (PubChem CID 68544848) has the molecular formula C22H25N3O3 and a molecular weight of 379.46 g/mol. Its IUPAC name is 10-oxo-10-(1,10-phenanthrolin-5-ylamino)decanoic acid.
| Compound Name | 10-oxo-10-(1,10-phenanthrolin-5-ylamino)decanoic acid |
|---|---|
| PubChem CID | 68544848 |
| Molecular Formula | C22H25N3O3 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | 10-oxo-10-(1,10-phenanthrolin-5-ylamino)decanoic acid |
| SMILES | O=C(O)CCCCCCCCC(=O)Nc1cc2cccnc2c2ncccc12 |
| InChI | InChI=1S/C22H25N3O3/c26-19(11-5-3-1-2-4-6-12-20(27)28)25-18-15-16-9-7-13-23-21(16)22-17(18)10-8-14-24-22/h7-10,13-15H,1-6,11-12H2,(H,25,26)(H,27,28) |
| InChIKey | BNQOOSRSKCCVGM-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|