C24H23N3O4 — CID 91324787
4-(4,4-dimethyl-2,6-dioxocyclohexyl)-4-oxo-N-(1,10-phenanthrolin-5-yl)butanamide (PubChem CID 91324787) has the molecular formula C24H23N3O4 and a molecular weight of 417.47 g/mol. Its IUPAC name is 4-(4,4-dimethyl-2,6-dioxocyclohexyl)-4-oxo-N-(1,10-phenanthrolin-5-yl)butanamide.
| Compound Name | 4-(4,4-dimethyl-2,6-dioxocyclohexyl)-4-oxo-N-(1,10-phenanthrolin-5-yl)butanamide |
|---|---|
| PubChem CID | 91324787 |
| Molecular Formula | C24H23N3O4 |
| Molecular Weight | 417.47 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | 4-(4,4-dimethyl-2,6-dioxocyclohexyl)-4-oxo-N-(1,10-phenanthrolin-5-yl)butanamide |
| SMILES | CC1(C)CC(=O)C(C(=O)CCC(=O)Nc2cc3cccnc3c3ncccc23)C(=O)C1 |
| InChI | InChI=1S/C24H23N3O4/c1-24(2)12-18(29)21(19(30)13-24)17(28)7-8-20(31)27-16-11-14-5-3-9-25-22(14)23-15(16)6-4-10-26-23/h3-6,9-11,21H,7-8,12-13H2,1-2H3,(H,27,31) |
| InChIKey | IIGPYSMDOFOIOR-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 106.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.47 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|