C16H14N4O2 — CID 12017524
4-N,7-N-dimethyl-1,10-phenanthroline-4,7-dicarboxamide (PubChem CID 12017524) has the molecular formula C16H14N4O2 and a molecular weight of 294.31 g/mol. Its IUPAC name is 4-N,7-N-dimethyl-1,10-phenanthroline-4,7-dicarboxamide.
| Compound Name | 4-N,7-N-dimethyl-1,10-phenanthroline-4,7-dicarboxamide |
|---|---|
| PubChem CID | 12017524 |
| Molecular Formula | C16H14N4O2 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | 4-N,7-N-dimethyl-1,10-phenanthroline-4,7-dicarboxamide |
| SMILES | CNC(=O)c1ccnc2c1ccc1c(C(=O)NC)ccnc12 |
| InChI | InChI=1S/C16H14N4O2/c1-17-15(21)11-5-7-19-13-9(11)3-4-10-12(16(22)18-2)6-8-20-14(10)13/h3-8H,1-2H3,(H,17,21)(H,18,22) |
| InChIKey | NPMFEGSJEGXTAV-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|