C17H25N3O — CID 144832127
8-(3-aminoprop-1-en-2-yl)-N-methylquinoline-4-carboxamide;ethane;methane (PubChem CID 144832127) has the molecular formula C17H25N3O and a molecular weight of 287.41 g/mol. Its IUPAC name is 8-(3-aminoprop-1-en-2-yl)-N-methylquinoline-4-carboxamide;ethane;methane.
| Compound Name | 8-(3-aminoprop-1-en-2-yl)-N-methylquinoline-4-carboxamide;ethane;methane |
|---|---|
| PubChem CID | 144832127 |
| Molecular Formula | C17H25N3O |
| Molecular Weight | 287.41 g/mol |
| Exact Mass | 287.20 |
| IUPAC Name | 8-(3-aminoprop-1-en-2-yl)-N-methylquinoline-4-carboxamide;ethane;methane |
| SMILES | C.C=C(CN)c1cccc2c(C(=O)NC)ccnc12.CC |
| InChI | InChI=1S/C14H15N3O.C2H6.CH4/c1-9(8-15)10-4-3-5-11-12(14(18)16-2)6-7-17-13(10)11;1-2;/h3-7H,1,8,15H2,2H3,(H,16,18);1-2H3;1H4 |
| InChIKey | LLWQSRQGCJBWGV-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.41 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |