About (7-benzoyl-1,10-phenanthrolin-4-yl)-phenylmethanone
(7-benzoyl-1,10-phenanthrolin-4-yl)-phenylmethanone (PubChem CID 175025470) has the molecular formula C26H16N2O2
and a molecular weight of 388.43 g/mol. Its IUPAC name is (7-benzoyl-1,10-phenanthrolin-4-yl)-phenylmethanone.
Molecular Properties
| Compound Name | (7-benzoyl-1,10-phenanthrolin-4-yl)-phenylmethanone |
| PubChem CID | 175025470 |
| Molecular Formula | C26H16N2O2 |
| Molecular Weight | 388.43 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | (7-benzoyl-1,10-phenanthrolin-4-yl)-phenylmethanone |
| SMILES | O=C(c1ccccc1)c1ccnc2c1ccc1c(C(=O)c3ccccc3)ccnc12 |
| InChI | InChI=1S/C26H16N2O2/c29-25(17-7-3-1-4-8-17)21-13-15-27-23-19(21)11-12-20-22(14-16-28-24(20)23)26(30)18-9-5-2-6-10-18/h1-16H |
| InChIKey | GXOJZJPHICADTL-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 59.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 388.43 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze (7-benzoyl-1,10-phenanthrolin-4-yl)-phenylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7-benzoyl-1,10-phenanthrolin-4-yl)-phenylmethanone?
The IUPAC name of (7-benzoyl-1,10-phenanthrolin-4-yl)-phenylmethanone (CID 175025470) is (7-benzoyl-1,10-phenanthrolin-4-yl)-phenylmethanone.
What is the SMILES notation for (7-benzoyl-1,10-phenanthrolin-4-yl)-phenylmethanone?
The canonical SMILES for (7-benzoyl-1,10-phenanthrolin-4-yl)-phenylmethanone is O=C(c1ccccc1)c1ccnc2c1ccc1c(C(=O)c3ccccc3)ccnc12.
What is the InChIKey of (7-benzoyl-1,10-phenanthrolin-4-yl)-phenylmethanone?
The InChIKey is GXOJZJPHICADTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H16N2O2/c29-25(17-7-3-1-4-8-17)21-13-15-27-23-19(21)11-12-20-22(14-16-28-24(20)23)26(30)18-9-5-2-6-10-18/h1-16H.
What are the key properties of (7-benzoyl-1,10-phenanthrolin-4-yl)-phenylmethanone?
(7-benzoyl-1,10-phenanthrolin-4-yl)-phenylmethanone has a molecular weight of 388.43 g/mol, XLogP of 5.24, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (7-benzoyl-1,10-phenanthrolin-4-yl)-phenylmethanone is sourced from PubChem (CID 175025470), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).