C33H39N7O10S — CID 59523612
3-[[5-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethylamino]-5-oxopentyl]amino]-3-oxo-2-[[5-oxo-5-(1,10-phenanthrolin-5-ylamino)pentanoyl]amino]propane-1-sulfonic acid (PubChem CID 59523612) has the molecular formula C33H39N7O10S and a molecular weight of 725.78 g/mol. Its IUPAC name is 3-[[5-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethylamino]-5-oxopentyl]amino]-3-oxo-2-[[5-oxo-5-(1,10-phenanthrolin-5-ylamino)pentanoyl]amino]propane-1-sulfonic acid.
| Compound Name | 3-[[5-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethylamino]-5-oxopentyl]amino]-3-oxo-2-[[5-oxo-5-(1,10-phenanthrolin-5-ylamino)pentanoyl]amino]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 59523612 |
| Molecular Formula | C33H39N7O10S |
| Molecular Weight | 725.78 g/mol |
| Exact Mass | 725.25 |
| IUPAC Name | 3-[[5-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethylamino]-5-oxopentyl]amino]-3-oxo-2-[[5-oxo-5-(1,10-phenanthrolin-5-ylamino)pentanoyl]amino]propane-1-sulfonic acid |
| SMILES | O=C(CCCCNC(=O)C(CS(=O)(=O)O)NC(=O)CCCC(=O)Nc1cc2cccnc2c2ncccc12)NCCOCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C33H39N7O10S/c41-26(34-16-18-50-19-17-40-29(44)11-12-30(40)45)8-1-2-13-37-33(46)25(21-51(47,48)49)39-28(43)10-3-9-27(42)38-24-20-22-6-4-14-35-31(22)32-23(24)7-5-15-36-32/h4-7,11-12,14-15,20,25H,1-3,8-10,13,16-19,21H2,(H,34,41)(H,37,46)(H,38,42)(H,39,43)(H,47,48,49) |
| InChIKey | CSSPFZSXJVZPQL-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 243.16 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 725.78 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|