C31H40N8O14 — CID 59481943
N,N'-bis[4-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethylamino]-1-formamido-1,4-dioxobutan-2-yl]pentanediamide (PubChem CID 59481943) has the molecular formula C31H40N8O14 and a molecular weight of 748.70 g/mol. Its IUPAC name is N,N'-bis[4-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethylamino]-1-formamido-1,4-dioxobutan-2-yl]pentanediamide.
| Compound Name | N,N'-bis[4-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethylamino]-1-formamido-1,4-dioxobutan-2-yl]pentanediamide |
|---|---|
| PubChem CID | 59481943 |
| Molecular Formula | C31H40N8O14 |
| Molecular Weight | 748.70 g/mol |
| Exact Mass | 748.27 |
| IUPAC Name | N,N'-bis[4-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethylamino]-1-formamido-1,4-dioxobutan-2-yl]pentanediamide |
| SMILES | O=CNC(=O)C(CC(=O)NCCOCCN1C(=O)C=CC1=O)NC(=O)CCCC(=O)NC(CC(=O)NCCOCCN1C(=O)C=CC1=O)C(=O)NC=O |
| InChI | InChI=1S/C31H40N8O14/c40-18-34-30(50)20(16-24(44)32-8-12-52-14-10-38-26(46)4-5-27(38)47)36-22(42)2-1-3-23(43)37-21(31(51)35-19-41)17-25(45)33-9-13-53-15-11-39-28(48)6-7-29(39)49/h4-7,18-21H,1-3,8-17H2,(H,32,44)(H,33,45)(H,36,42)(H,37,43)(H,34,40,50)(H,35,41,51) |
| InChIKey | QIDMPLPDQDDMKA-UHFFFAOYSA-N |
| XLogP | -5.43 |
| TPSA | 301.96 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.70 |
| LogP ≤ 5 | -5.43 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|