C25H31N5O9 — CID 59481932
[4-[[4-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethylamino]-4-oxo-2-(propanoylamino)butanoyl]carbamoylamino]phenyl]methyl acetate (PubChem CID 59481932) has the molecular formula C25H31N5O9 and a molecular weight of 545.55 g/mol. Its IUPAC name is [4-[[4-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethylamino]-4-oxo-2-(propanoylamino)butanoyl]carbamoylamino]phenyl]methyl acetate.
| Compound Name | [4-[[4-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethylamino]-4-oxo-2-(propanoylamino)butanoyl]carbamoylamino]phenyl]methyl acetate |
|---|---|
| PubChem CID | 59481932 |
| Molecular Formula | C25H31N5O9 |
| Molecular Weight | 545.55 g/mol |
| Exact Mass | 545.21 |
| IUPAC Name | [4-[[4-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethylamino]-4-oxo-2-(propanoylamino)butanoyl]carbamoylamino]phenyl]methyl acetate |
| SMILES | CCC(=O)NC(CC(=O)NCCOCCN1C(=O)C=CC1=O)C(=O)NC(=O)Nc1ccc(COC(C)=O)cc1 |
| InChI | InChI=1S/C25H31N5O9/c1-3-20(32)28-19(14-21(33)26-10-12-38-13-11-30-22(34)8-9-23(30)35)24(36)29-25(37)27-18-6-4-17(5-7-18)15-39-16(2)31/h4-9,19H,3,10-15H2,1-2H3,(H,26,33)(H,28,32)(H2,27,29,36,37) |
| InChIKey | LUWUEPLWRMILFA-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 189.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.55 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|