C31H48N6O10 — CID 166454080
[4-[[2-[[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxycarbonylamino]-3-methylbutanoyl]amino]acetyl]amino]phenyl]methyl acetate;ethane;propylurea (PubChem CID 166454080) has the molecular formula C31H48N6O10 and a molecular weight of 664.76 g/mol. Its IUPAC name is [4-[[2-[[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxycarbonylamino]-3-methylbutanoyl]amino]acetyl]amino]phenyl]methyl acetate;ethane;propylurea.
| Compound Name | [4-[[2-[[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxycarbonylamino]-3-methylbutanoyl]amino]acetyl]amino]phenyl]methyl acetate;ethane;propylurea |
|---|---|
| PubChem CID | 166454080 |
| Molecular Formula | C31H48N6O10 |
| Molecular Weight | 664.76 g/mol |
| Exact Mass | 664.34 |
| IUPAC Name | [4-[[2-[[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxycarbonylamino]-3-methylbutanoyl]amino]acetyl]amino]phenyl]methyl acetate;ethane;propylurea |
| SMILES | CC.CC(=O)OCc1ccc(NC(=O)CNC(=O)C(NC(=O)OCCOCCN2C(=O)C=CC2=O)C(C)C)cc1.CCCNC(N)=O |
| InChI | InChI=1S/C25H32N4O9.C4H10N2O.C2H6/c1-16(2)23(28-25(35)37-13-12-36-11-10-29-21(32)8-9-22(29)33)24(34)26-14-20(31)27-19-6-4-18(5-7-19)15-38-17(3)30;1-2-3-6-4(5)7;1-2/h4-9,16,23H,10-15H2,1-3H3,(H,26,34)(H,27,31)(H,28,35);2-3H2,1H3,(H3,5,6,7);1-2H3 |
| InChIKey | XSEFVNYNDAOZRG-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 224.56 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.76 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|