C22H34N4O9S — CID 121313368
(2R)-2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-3-[[(2S)-3-methyl-1-oxo-1-[[(2S)-3-oxobutan-2-yl]amino]butan-2-yl]amino]-3-oxopropane-1-sulfonic acid (PubChem CID 121313368) has the molecular formula C22H34N4O9S and a molecular weight of 530.60 g/mol. Its IUPAC name is (2R)-2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-3-[[(2S)-3-methyl-1-oxo-1-[[(2S)-3-oxobutan-2-yl]amino]butan-2-yl]amino]-3-oxopropane-1-sulfonic acid.
| Compound Name | (2R)-2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-3-[[(2S)-3-methyl-1-oxo-1-[[(2S)-3-oxobutan-2-yl]amino]butan-2-yl]amino]-3-oxopropane-1-sulfonic acid |
|---|---|
| PubChem CID | 121313368 |
| Molecular Formula | C22H34N4O9S |
| Molecular Weight | 530.60 g/mol |
| Exact Mass | 530.20 |
| IUPAC Name | (2R)-2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-3-[[(2S)-3-methyl-1-oxo-1-[[(2S)-3-oxobutan-2-yl]amino]butan-2-yl]amino]-3-oxopropane-1-sulfonic acid |
| SMILES | CC(=O)[C@H](C)NC(=O)[C@@H](NC(=O)[C@H](CS(=O)(=O)O)NC(=O)CCCCCN1C(=O)C=CC1=O)C(C)C |
| InChI | InChI=1S/C22H34N4O9S/c1-13(2)20(22(32)23-14(3)15(4)27)25-21(31)16(12-36(33,34)35)24-17(28)8-6-5-7-11-26-18(29)9-10-19(26)30/h9-10,13-14,16,20H,5-8,11-12H2,1-4H3,(H,23,32)(H,24,28)(H,25,31)(H,33,34,35)/t14-,16-,20-/m0/s1 |
| InChIKey | CZJKFLCFTYQRAO-UVFQYZLESA-N |
| XLogP | -0.92 |
| TPSA | 196.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.60 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|