C22H30N4O8 — CID 175170577
(2,5-dioxopyrrolidin-1-yl) 2-[[2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-3-methylbutanoyl]amino]propanoate (PubChem CID 175170577) has the molecular formula C22H30N4O8 and a molecular weight of 478.50 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 2-[[2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-3-methylbutanoyl]amino]propanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 2-[[2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-3-methylbutanoyl]amino]propanoate |
|---|---|
| PubChem CID | 175170577 |
| Molecular Formula | C22H30N4O8 |
| Molecular Weight | 478.50 g/mol |
| Exact Mass | 478.21 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 2-[[2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-3-methylbutanoyl]amino]propanoate |
| SMILES | CC(NC(=O)C(NC(=O)CCCCCN1C(=O)C=CC1=O)C(C)C)C(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C22H30N4O8/c1-13(2)20(21(32)23-14(3)22(33)34-26-18(30)10-11-19(26)31)24-15(27)7-5-4-6-12-25-16(28)8-9-17(25)29/h8-9,13-14,20H,4-7,10-12H2,1-3H3,(H,23,32)(H,24,27) |
| InChIKey | NAPROGZILYBSEW-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 159.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.50 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|