C25H39N3O9S — CID 157199898
(2R)-2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-3-oxo-3-[[(3S,6R)-2,6,8-trimethyl-4,7-dioxononan-3-yl]amino]propane-1-sulfonic acid (PubChem CID 157199898) has the molecular formula C25H39N3O9S and a molecular weight of 557.67 g/mol. Its IUPAC name is (2R)-2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-3-oxo-3-[[(3S,6R)-2,6,8-trimethyl-4,7-dioxononan-3-yl]amino]propane-1-sulfonic acid.
| Compound Name | (2R)-2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-3-oxo-3-[[(3S,6R)-2,6,8-trimethyl-4,7-dioxononan-3-yl]amino]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 157199898 |
| Molecular Formula | C25H39N3O9S |
| Molecular Weight | 557.67 g/mol |
| Exact Mass | 557.24 |
| IUPAC Name | (2R)-2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-3-oxo-3-[[(3S,6R)-2,6,8-trimethyl-4,7-dioxononan-3-yl]amino]propane-1-sulfonic acid |
| SMILES | CC(C)C(=O)[C@H](C)CC(=O)[C@@H](NC(=O)[C@H](CS(=O)(=O)O)NC(=O)CCCCCN1C(=O)C=CC1=O)C(C)C |
| InChI | InChI=1S/C25H39N3O9S/c1-15(2)23(19(29)13-17(5)24(33)16(3)4)27-25(34)18(14-38(35,36)37)26-20(30)9-7-6-8-12-28-21(31)10-11-22(28)32/h10-11,15-18,23H,6-9,12-14H2,1-5H3,(H,26,30)(H,27,34)(H,35,36,37)/t17-,18+,23+/m1/s1 |
| InChIKey | ZNMIXBJBGMCPDI-STSQHVNTSA-N |
| XLogP | 0.81 |
| TPSA | 184.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.67 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|