C17H18N4O — CID 4016774
1,1-diethyl-3-(4,7-phenanthrolin-5-yl)urea (PubChem CID 4016774) has the molecular formula C17H18N4O and a molecular weight of 294.36 g/mol. Its IUPAC name is 1,1-diethyl-3-(4,7-phenanthrolin-5-yl)urea.
| Compound Name | 1,1-diethyl-3-(4,7-phenanthrolin-5-yl)urea |
|---|---|
| PubChem CID | 4016774 |
| Molecular Formula | C17H18N4O |
| Molecular Weight | 294.36 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | 1,1-diethyl-3-(4,7-phenanthrolin-5-yl)urea |
| SMILES | CCN(CC)C(=O)Nc1cc2ncccc2c2cccnc12 |
| InChI | InChI=1S/C17H18N4O/c1-3-21(4-2)17(22)20-15-11-14-12(7-5-9-18-14)13-8-6-10-19-16(13)15/h5-11H,3-4H2,1-2H3,(H,20,22) |
| InChIKey | KBFXJPTYBFELTG-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.36 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|