C12H16N4O4 — CID 104743381
3-[[ethyl-[2-(methylamino)-2-oxoethyl]carbamoyl]amino]pyridine-2-carboxylic acid (PubChem CID 104743381) has the molecular formula C12H16N4O4 and a molecular weight of 280.28 g/mol. Its IUPAC name is 3-[[ethyl-[2-(methylamino)-2-oxoethyl]carbamoyl]amino]pyridine-2-carboxylic acid.
| Compound Name | 3-[[ethyl-[2-(methylamino)-2-oxoethyl]carbamoyl]amino]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 104743381 |
| Molecular Formula | C12H16N4O4 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | 3-[[ethyl-[2-(methylamino)-2-oxoethyl]carbamoyl]amino]pyridine-2-carboxylic acid |
| SMILES | CCN(CC(=O)NC)C(=O)Nc1cccnc1C(=O)O |
| InChI | InChI=1S/C12H16N4O4/c1-3-16(7-9(17)13-2)12(20)15-8-5-4-6-14-10(8)11(18)19/h4-6H,3,7H2,1-2H3,(H,13,17)(H,15,20)(H,18,19) |
| InChIKey | DQDSHMHCJHORDG-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 111.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |