C13H16BrN3O4 — CID 61449996
4-bromo-2-[[ethyl-[2-(methylamino)-2-oxoethyl]carbamoyl]amino]benzoic acid (PubChem CID 61449996) has the molecular formula C13H16BrN3O4 and a molecular weight of 358.19 g/mol. Its IUPAC name is 4-bromo-2-[[ethyl-[2-(methylamino)-2-oxoethyl]carbamoyl]amino]benzoic acid.
| Compound Name | 4-bromo-2-[[ethyl-[2-(methylamino)-2-oxoethyl]carbamoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 61449996 |
| Molecular Formula | C13H16BrN3O4 |
| Molecular Weight | 358.19 g/mol |
| Exact Mass | 357.03 |
| IUPAC Name | 4-bromo-2-[[ethyl-[2-(methylamino)-2-oxoethyl]carbamoyl]amino]benzoic acid |
| SMILES | CCN(CC(=O)NC)C(=O)Nc1cc(Br)ccc1C(=O)O |
| InChI | InChI=1S/C13H16BrN3O4/c1-3-17(7-11(18)15-2)13(21)16-10-6-8(14)4-5-9(10)12(19)20/h4-6H,3,7H2,1-2H3,(H,15,18)(H,16,21)(H,19,20) |
| InChIKey | LDSAWYBCROIZHZ-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.19 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |