C14H15ClN2O2 — CID 712597
(5-chloroquinolin-8-yl) N,N-diethylcarbamate (PubChem CID 712597) has the molecular formula C14H15ClN2O2 and a molecular weight of 278.74 g/mol. Its IUPAC name is (5-chloroquinolin-8-yl) N,N-diethylcarbamate.
| Compound Name | (5-chloroquinolin-8-yl) N,N-diethylcarbamate |
|---|---|
| PubChem CID | 712597 |
| Molecular Formula | C14H15ClN2O2 |
| Molecular Weight | 278.74 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | (5-chloroquinolin-8-yl) N,N-diethylcarbamate |
| SMILES | CCN(CC)C(=O)Oc1ccc(Cl)c2cccnc12 |
| InChI | InChI=1S/C14H15ClN2O2/c1-3-17(4-2)14(18)19-12-8-7-11(15)10-6-5-9-16-13(10)12/h5-9H,3-4H2,1-2H3 |
| InChIKey | LCTBGKGAFQLOSY-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.74 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |