C14H13ClN2O4 — CID 13338827
ethyl 2-[(5-chloroquinolin-8-yl)oxycarbonylamino]acetate (PubChem CID 13338827) has the molecular formula C14H13ClN2O4 and a molecular weight of 308.72 g/mol. Its IUPAC name is ethyl 2-[(5-chloroquinolin-8-yl)oxycarbonylamino]acetate.
| Compound Name | ethyl 2-[(5-chloroquinolin-8-yl)oxycarbonylamino]acetate |
|---|---|
| PubChem CID | 13338827 |
| Molecular Formula | C14H13ClN2O4 |
| Molecular Weight | 308.72 g/mol |
| Exact Mass | 308.06 |
| IUPAC Name | ethyl 2-[(5-chloroquinolin-8-yl)oxycarbonylamino]acetate |
| SMILES | CCOC(=O)CNC(=O)Oc1ccc(Cl)c2cccnc12 |
| InChI | InChI=1S/C14H13ClN2O4/c1-2-20-12(18)8-17-14(19)21-11-6-5-10(15)9-4-3-7-16-13(9)11/h3-7H,2,8H2,1H3,(H,17,19) |
| InChIKey | XPYWNWNKXBGQEM-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.72 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |