C15H17F2N3O2 — CID 60554221
3-[8-(difluoromethoxy)quinolin-5-yl]-1,1-diethylurea (PubChem CID 60554221) has the molecular formula C15H17F2N3O2 and a molecular weight of 309.32 g/mol. Its IUPAC name is 3-[8-(difluoromethoxy)quinolin-5-yl]-1,1-diethylurea.
| Compound Name | 3-[8-(difluoromethoxy)quinolin-5-yl]-1,1-diethylurea |
|---|---|
| PubChem CID | 60554221 |
| Molecular Formula | C15H17F2N3O2 |
| Molecular Weight | 309.32 g/mol |
| Exact Mass | 309.13 |
| IUPAC Name | 3-[8-(difluoromethoxy)quinolin-5-yl]-1,1-diethylurea |
| SMILES | CCN(CC)C(=O)Nc1ccc(OC(F)F)c2ncccc12 |
| InChI | InChI=1S/C15H17F2N3O2/c1-3-20(4-2)15(21)19-11-7-8-12(22-14(16)17)13-10(11)6-5-9-18-13/h5-9,14H,3-4H2,1-2H3,(H,19,21) |
| InChIKey | ZPOOBNOOYSKKNX-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.32 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |