C17H17F2N5O2 — CID 60549695
1-[8-(difluoromethoxy)quinolin-5-yl]-3-(3-imidazol-1-ylpropyl)urea (PubChem CID 60549695) has the molecular formula C17H17F2N5O2 and a molecular weight of 361.35 g/mol. Its IUPAC name is 1-[8-(difluoromethoxy)quinolin-5-yl]-3-(3-imidazol-1-ylpropyl)urea.
| Compound Name | 1-[8-(difluoromethoxy)quinolin-5-yl]-3-(3-imidazol-1-ylpropyl)urea |
|---|---|
| PubChem CID | 60549695 |
| Molecular Formula | C17H17F2N5O2 |
| Molecular Weight | 361.35 g/mol |
| Exact Mass | 361.14 |
| IUPAC Name | 1-[8-(difluoromethoxy)quinolin-5-yl]-3-(3-imidazol-1-ylpropyl)urea |
| SMILES | O=C(NCCCn1ccnc1)Nc1ccc(OC(F)F)c2ncccc12 |
| InChI | InChI=1S/C17H17F2N5O2/c18-16(19)26-14-5-4-13(12-3-1-6-21-15(12)14)23-17(25)22-7-2-9-24-10-8-20-11-24/h1,3-6,8,10-11,16H,2,7,9H2,(H2,22,23,25) |
| InChIKey | RPSDTKBTILLVQQ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.35 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|