C15H17F2N3O3 — CID 51155757
4-(difluoromethoxy)-N-(3-imidazol-1-ylpropyl)-3-methoxybenzamide (PubChem CID 51155757) has the molecular formula C15H17F2N3O3 and a molecular weight of 325.32 g/mol. Its IUPAC name is 4-(difluoromethoxy)-N-(3-imidazol-1-ylpropyl)-3-methoxybenzamide.
| Compound Name | 4-(difluoromethoxy)-N-(3-imidazol-1-ylpropyl)-3-methoxybenzamide |
|---|---|
| PubChem CID | 51155757 |
| Molecular Formula | C15H17F2N3O3 |
| Molecular Weight | 325.32 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | 4-(difluoromethoxy)-N-(3-imidazol-1-ylpropyl)-3-methoxybenzamide |
| SMILES | COc1cc(C(=O)NCCCn2ccnc2)ccc1OC(F)F |
| InChI | InChI=1S/C15H17F2N3O3/c1-22-13-9-11(3-4-12(13)23-15(16)17)14(21)19-5-2-7-20-8-6-18-10-20/h3-4,6,8-10,15H,2,5,7H2,1H3,(H,19,21) |
| InChIKey | JTJIGPSVMKNKMV-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.32 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|