C22H26N4O4S — CID 55976917
N-(4-imidazol-1-ylbutyl)-4-methoxy-3-[(4-methylphenyl)sulfamoyl]benzamide (PubChem CID 55976917) has the molecular formula C22H26N4O4S and a molecular weight of 442.54 g/mol. Its IUPAC name is N-(4-imidazol-1-ylbutyl)-4-methoxy-3-[(4-methylphenyl)sulfamoyl]benzamide.
| Compound Name | N-(4-imidazol-1-ylbutyl)-4-methoxy-3-[(4-methylphenyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 55976917 |
| Molecular Formula | C22H26N4O4S |
| Molecular Weight | 442.54 g/mol |
| Exact Mass | 442.17 |
| IUPAC Name | N-(4-imidazol-1-ylbutyl)-4-methoxy-3-[(4-methylphenyl)sulfamoyl]benzamide |
| SMILES | COc1ccc(C(=O)NCCCCn2ccnc2)cc1S(=O)(=O)Nc1ccc(C)cc1 |
| InChI | InChI=1S/C22H26N4O4S/c1-17-5-8-19(9-6-17)25-31(28,29)21-15-18(7-10-20(21)30-2)22(27)24-11-3-4-13-26-14-12-23-16-26/h5-10,12,14-16,25H,3-4,11,13H2,1-2H3,(H,24,27) |
| InChIKey | CGXUQDYWWMNQKQ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 102.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.54 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|