C16H19N5O — CID 56823902
1-(3-imidazol-1-ylpropyl)-3-(1-methylindol-4-yl)urea (PubChem CID 56823902) has the molecular formula C16H19N5O and a molecular weight of 297.36 g/mol. Its IUPAC name is 1-(3-imidazol-1-ylpropyl)-3-(1-methylindol-4-yl)urea.
| Compound Name | 1-(3-imidazol-1-ylpropyl)-3-(1-methylindol-4-yl)urea |
|---|---|
| PubChem CID | 56823902 |
| Molecular Formula | C16H19N5O |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.16 |
| IUPAC Name | 1-(3-imidazol-1-ylpropyl)-3-(1-methylindol-4-yl)urea |
| SMILES | Cn1ccc2c(NC(=O)NCCCn3ccnc3)cccc21 |
| InChI | InChI=1S/C16H19N5O/c1-20-10-6-13-14(4-2-5-15(13)20)19-16(22)18-7-3-9-21-11-8-17-12-21/h2,4-6,8,10-12H,3,7,9H2,1H3,(H2,18,19,22) |
| InChIKey | IPDWLAKZWKGDDG-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 63.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|