C19H25N5O3 — CID 60569650
1-(3-imidazol-1-ylpropyl)-3-[2-methyl-3-(morpholine-4-carbonyl)phenyl]urea (PubChem CID 60569650) has the molecular formula C19H25N5O3 and a molecular weight of 371.44 g/mol. Its IUPAC name is 1-(3-imidazol-1-ylpropyl)-3-[2-methyl-3-(morpholine-4-carbonyl)phenyl]urea.
| Compound Name | 1-(3-imidazol-1-ylpropyl)-3-[2-methyl-3-(morpholine-4-carbonyl)phenyl]urea |
|---|---|
| PubChem CID | 60569650 |
| Molecular Formula | C19H25N5O3 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.20 |
| IUPAC Name | 1-(3-imidazol-1-ylpropyl)-3-[2-methyl-3-(morpholine-4-carbonyl)phenyl]urea |
| SMILES | Cc1c(NC(=O)NCCCn2ccnc2)cccc1C(=O)N1CCOCC1 |
| InChI | InChI=1S/C19H25N5O3/c1-15-16(18(25)24-10-12-27-13-11-24)4-2-5-17(15)22-19(26)21-6-3-8-23-9-7-20-14-23/h2,4-5,7,9,14H,3,6,8,10-13H2,1H3,(H2,21,22,26) |
| InChIKey | SIWPDJBMZVFZEB-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 88.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|