C16H16F2N2O3 — CID 99842569
N-[8-(difluoromethoxy)quinolin-5-yl]-2-[(2R)-oxolan-2-yl]acetamide (PubChem CID 99842569) has the molecular formula C16H16F2N2O3 and a molecular weight of 322.31 g/mol. Its IUPAC name is N-[8-(difluoromethoxy)quinolin-5-yl]-2-[(2R)-oxolan-2-yl]acetamide.
| Compound Name | N-[8-(difluoromethoxy)quinolin-5-yl]-2-[(2R)-oxolan-2-yl]acetamide |
|---|---|
| PubChem CID | 99842569 |
| Molecular Formula | C16H16F2N2O3 |
| Molecular Weight | 322.31 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | N-[8-(difluoromethoxy)quinolin-5-yl]-2-[(2R)-oxolan-2-yl]acetamide |
| SMILES | O=C(C[C@H]1CCCO1)Nc1ccc(OC(F)F)c2ncccc12 |
| InChI | InChI=1S/C16H16F2N2O3/c17-16(18)23-13-6-5-12(11-4-1-7-19-15(11)13)20-14(21)9-10-3-2-8-22-10/h1,4-7,10,16H,2-3,8-9H2,(H,20,21)/t10-/m1/s1 |
| InChIKey | SHYRLZZYVYKPCF-SNVBAGLBSA-N |
| XLogP | 3.34 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.31 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |