C17H18BrNO2 — CID 115897768
N-(4-bromonaphthalen-1-yl)-2-(oxan-2-yl)acetamide (PubChem CID 115897768) has the molecular formula C17H18BrNO2 and a molecular weight of 348.24 g/mol. Its IUPAC name is N-(4-bromonaphthalen-1-yl)-2-(oxan-2-yl)acetamide.
| Compound Name | N-(4-bromonaphthalen-1-yl)-2-(oxan-2-yl)acetamide |
|---|---|
| PubChem CID | 115897768 |
| Molecular Formula | C17H18BrNO2 |
| Molecular Weight | 348.24 g/mol |
| Exact Mass | 347.05 |
| IUPAC Name | N-(4-bromonaphthalen-1-yl)-2-(oxan-2-yl)acetamide |
| SMILES | O=C(CC1CCCCO1)Nc1ccc(Br)c2ccccc12 |
| InChI | InChI=1S/C17H18BrNO2/c18-15-8-9-16(14-7-2-1-6-13(14)15)19-17(20)11-12-5-3-4-10-21-12/h1-2,6-9,12H,3-5,10-11H2,(H,19,20) |
| InChIKey | ZXKGEISDDMKYRU-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.24 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |