C18H16ClF2N3O2S — CID 60553928
1-[(5-chlorothiophen-2-yl)methyl]-3-[8-(difluoromethoxy)quinolin-5-yl]-1-ethylurea (PubChem CID 60553928) has the molecular formula C18H16ClF2N3O2S and a molecular weight of 411.86 g/mol. Its IUPAC name is 1-[(5-chlorothiophen-2-yl)methyl]-3-[8-(difluoromethoxy)quinolin-5-yl]-1-ethylurea.
| Compound Name | 1-[(5-chlorothiophen-2-yl)methyl]-3-[8-(difluoromethoxy)quinolin-5-yl]-1-ethylurea |
|---|---|
| PubChem CID | 60553928 |
| Molecular Formula | C18H16ClF2N3O2S |
| Molecular Weight | 411.86 g/mol |
| Exact Mass | 411.06 |
| IUPAC Name | 1-[(5-chlorothiophen-2-yl)methyl]-3-[8-(difluoromethoxy)quinolin-5-yl]-1-ethylurea |
| SMILES | CCN(Cc1ccc(Cl)s1)C(=O)Nc1ccc(OC(F)F)c2ncccc12 |
| InChI | InChI=1S/C18H16ClF2N3O2S/c1-2-24(10-11-5-8-15(19)27-11)18(25)23-13-6-7-14(26-17(20)21)16-12(13)4-3-9-22-16/h3-9,17H,2,10H2,1H3,(H,23,25) |
| InChIKey | DBZCOBQDNTTYRO-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.86 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |