C23H25F2N3O3 — CID 60582989
1-benzyl-3-[8-(difluoromethoxy)quinolin-5-yl]-1-(4-methoxybutyl)urea (PubChem CID 60582989) has the molecular formula C23H25F2N3O3 and a molecular weight of 429.47 g/mol. Its IUPAC name is 1-benzyl-3-[8-(difluoromethoxy)quinolin-5-yl]-1-(4-methoxybutyl)urea.
| Compound Name | 1-benzyl-3-[8-(difluoromethoxy)quinolin-5-yl]-1-(4-methoxybutyl)urea |
|---|---|
| PubChem CID | 60582989 |
| Molecular Formula | C23H25F2N3O3 |
| Molecular Weight | 429.47 g/mol |
| Exact Mass | 429.19 |
| IUPAC Name | 1-benzyl-3-[8-(difluoromethoxy)quinolin-5-yl]-1-(4-methoxybutyl)urea |
| SMILES | COCCCCN(Cc1ccccc1)C(=O)Nc1ccc(OC(F)F)c2ncccc12 |
| InChI | InChI=1S/C23H25F2N3O3/c1-30-15-6-5-14-28(16-17-8-3-2-4-9-17)23(29)27-19-11-12-20(31-22(24)25)21-18(19)10-7-13-26-21/h2-4,7-13,22H,5-6,14-16H2,1H3,(H,27,29) |
| InChIKey | GLRCDWFRBIFCCW-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.47 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|