C22H25N3O2S — CID 60583091
1-benzyl-1-(4-methoxybutyl)-3-(5-phenyl-1,3-thiazol-2-yl)urea (PubChem CID 60583091) has the molecular formula C22H25N3O2S and a molecular weight of 395.53 g/mol. Its IUPAC name is 1-benzyl-1-(4-methoxybutyl)-3-(5-phenyl-1,3-thiazol-2-yl)urea.
| Compound Name | 1-benzyl-1-(4-methoxybutyl)-3-(5-phenyl-1,3-thiazol-2-yl)urea |
|---|---|
| PubChem CID | 60583091 |
| Molecular Formula | C22H25N3O2S |
| Molecular Weight | 395.53 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | 1-benzyl-1-(4-methoxybutyl)-3-(5-phenyl-1,3-thiazol-2-yl)urea |
| SMILES | COCCCCN(Cc1ccccc1)C(=O)Nc1ncc(-c2ccccc2)s1 |
| InChI | InChI=1S/C22H25N3O2S/c1-27-15-9-8-14-25(17-18-10-4-2-5-11-18)22(26)24-21-23-16-20(28-21)19-12-6-3-7-13-19/h2-7,10-13,16H,8-9,14-15,17H2,1H3,(H,23,24,26) |
| InChIKey | YMDCZRJYDMGGNC-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.53 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|