C16H17ClF2N2O2S — CID 56557090
1-[(5-chlorothiophen-2-yl)methyl]-3-[2-(difluoromethoxy)-6-methylphenyl]-1-ethylurea (PubChem CID 56557090) has the molecular formula C16H17ClF2N2O2S and a molecular weight of 374.84 g/mol. Its IUPAC name is 1-[(5-chlorothiophen-2-yl)methyl]-3-[2-(difluoromethoxy)-6-methylphenyl]-1-ethylurea.
| Compound Name | 1-[(5-chlorothiophen-2-yl)methyl]-3-[2-(difluoromethoxy)-6-methylphenyl]-1-ethylurea |
|---|---|
| PubChem CID | 56557090 |
| Molecular Formula | C16H17ClF2N2O2S |
| Molecular Weight | 374.84 g/mol |
| Exact Mass | 374.07 |
| IUPAC Name | 1-[(5-chlorothiophen-2-yl)methyl]-3-[2-(difluoromethoxy)-6-methylphenyl]-1-ethylurea |
| SMILES | CCN(Cc1ccc(Cl)s1)C(=O)Nc1c(C)cccc1OC(F)F |
| InChI | InChI=1S/C16H17ClF2N2O2S/c1-3-21(9-11-7-8-13(17)24-11)16(22)20-14-10(2)5-4-6-12(14)23-15(18)19/h4-8,15H,3,9H2,1-2H3,(H,20,22) |
| InChIKey | ZQSOKXIXKKAYFU-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.84 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |