C21H20N4O2 — CID 4573339
1-cyclohexa-1,5-dien-1-yl-1-(2-hydroxyethyl)-3-(1,7-phenanthrolin-6-yl)urea (PubChem CID 4573339) has the molecular formula C21H20N4O2 and a molecular weight of 360.42 g/mol. Its IUPAC name is 1-cyclohexa-1,5-dien-1-yl-1-(2-hydroxyethyl)-3-(1,7-phenanthrolin-6-yl)urea.
| Compound Name | 1-cyclohexa-1,5-dien-1-yl-1-(2-hydroxyethyl)-3-(1,7-phenanthrolin-6-yl)urea |
|---|---|
| PubChem CID | 4573339 |
| Molecular Formula | C21H20N4O2 |
| Molecular Weight | 360.42 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | 1-cyclohexa-1,5-dien-1-yl-1-(2-hydroxyethyl)-3-(1,7-phenanthrolin-6-yl)urea |
| SMILES | O=C(Nc1cc2cccnc2c2cccnc12)N(CCO)C1=CCCC=C1 |
| InChI | InChI=1S/C21H20N4O2/c26-13-12-25(16-7-2-1-3-8-16)21(27)24-18-14-15-6-4-10-22-19(15)17-9-5-11-23-20(17)18/h2,4-11,14,26H,1,3,12-13H2,(H,24,27) |
| InChIKey | SHSNARFVJGNKEZ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.42 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|