C17H17N3O2 — CID 135453963
6-[4-(dimethylamino)anilino]quinoline-5,8-diol (PubChem CID 135453963) has the molecular formula C17H17N3O2 and a molecular weight of 295.34 g/mol. Its IUPAC name is 6-[4-(dimethylamino)anilino]quinoline-5,8-diol.
| Compound Name | 6-[4-(dimethylamino)anilino]quinoline-5,8-diol |
|---|---|
| PubChem CID | 135453963 |
| Molecular Formula | C17H17N3O2 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | 6-[4-(dimethylamino)anilino]quinoline-5,8-diol |
| SMILES | CN(C)c1ccc(Nc2cc(O)c3ncccc3c2O)cc1 |
| InChI | InChI=1S/C17H17N3O2/c1-20(2)12-7-5-11(6-8-12)19-14-10-15(21)16-13(17(14)22)4-3-9-18-16/h3-10,19,21-22H,1-2H3 |
| InChIKey | ZALNVBLTXUNJRJ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 68.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|