C10H9NO3 — CID 137159814
6-methylquinoline-5,7,8-triol (PubChem CID 137159814) has the molecular formula C10H9NO3 and a molecular weight of 191.19 g/mol. Its IUPAC name is 6-methylquinoline-5,7,8-triol.
| Compound Name | 6-methylquinoline-5,7,8-triol |
|---|---|
| PubChem CID | 137159814 |
| Molecular Formula | C10H9NO3 |
| Molecular Weight | 191.19 g/mol |
| Exact Mass | 191.06 |
| IUPAC Name | 6-methylquinoline-5,7,8-triol |
| SMILES | Cc1c(O)c(O)c2ncccc2c1O |
| InChI | InChI=1S/C10H9NO3/c1-5-8(12)6-3-2-4-11-7(6)10(14)9(5)13/h2-4,12-14H,1H3 |
| InChIKey | RMVBHSBPHLGZRJ-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.19 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|