C10H11N3O — CID 23063822
5,7-diamino-6-methylquinolin-8-ol (PubChem CID 23063822) has the molecular formula C10H11N3O and a molecular weight of 189.22 g/mol. Its IUPAC name is 5,7-diamino-6-methylquinolin-8-ol.
| Compound Name | 5,7-diamino-6-methylquinolin-8-ol |
|---|---|
| PubChem CID | 23063822 |
| Molecular Formula | C10H11N3O |
| Molecular Weight | 189.22 g/mol |
| Exact Mass | 189.09 |
| IUPAC Name | 5,7-diamino-6-methylquinolin-8-ol |
| SMILES | Cc1c(N)c(O)c2ncccc2c1N |
| InChI | InChI=1S/C10H11N3O/c1-5-7(11)6-3-2-4-13-9(6)10(14)8(5)12/h2-4,14H,11-12H2,1H3 |
| InChIKey | LKURDWAORLIZED-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 85.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.22 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|