C10H8Br2NO4Sb — CID 20836064
(5,7-dibromo-6-methylquinolin-8-yl)oxystibonic acid (PubChem CID 20836064) has the molecular formula C10H8Br2NO4Sb and a molecular weight of 487.75 g/mol. Its IUPAC name is (5,7-dibromo-6-methylquinolin-8-yl)oxystibonic acid.
| Compound Name | (5,7-dibromo-6-methylquinolin-8-yl)oxystibonic acid |
|---|---|
| PubChem CID | 20836064 |
| Molecular Formula | C10H8Br2NO4Sb |
| Molecular Weight | 487.75 g/mol |
| Exact Mass | 484.79 |
| IUPAC Name | (5,7-dibromo-6-methylquinolin-8-yl)oxystibonic acid |
| SMILES | Cc1c(Br)c(O[Sb](=O)(O)O)c2ncccc2c1Br |
| InChI | InChI=1S/C10H7Br2NO.2H2O.O.Sb/c1-5-7(11)6-3-2-4-13-9(6)10(14)8(5)12;;;;/h2-4,14H,1H3;2*1H2;;/q;;;;+3/p-3 |
| InChIKey | HHJLUXSDAYJYHA-UHFFFAOYSA-K |
| XLogP | 2.30 |
| TPSA | 79.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.75 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|