(5,7-dibromo-6-methylquinolin-8-yl)oxystibonic acid

C10H8Br2NO4Sb — CID 20836064

IUPAC(5,7-dibromo-6-methylquinolin-8-yl)oxystibonic acid
SMILESCc1c(Br)c(O[Sb](=O)(O)O)c2ncccc2c1Br
InChIInChI=1S/C10H7Br2NO.2H2O.O.Sb/c1-5-7(11)6-3-2-4-13-9(6)10(14)8(5)12;;;;/h2-4,14H,1H3;2*1H2;;/q;;;;+3/p-3
InChIKeyHHJLUXSDAYJYHA-UHFFFAOYSA-K
MW487.75 g/mol
LogP2.30
Rot. Bonds2

About (5,7-dibromo-6-methylquinolin-8-yl)oxystibonic acid

(5,7-dibromo-6-methylquinolin-8-yl)oxystibonic acid (PubChem CID 20836064) has the molecular formula C10H8Br2NO4Sb and a molecular weight of 487.75 g/mol. Its IUPAC name is (5,7-dibromo-6-methylquinolin-8-yl)oxystibonic acid.

Molecular Properties

Compound Name(5,7-dibromo-6-methylquinolin-8-yl)oxystibonic acid
PubChem CID20836064
Molecular FormulaC10H8Br2NO4Sb
Molecular Weight487.75 g/mol
Exact Mass484.79
IUPAC Name(5,7-dibromo-6-methylquinolin-8-yl)oxystibonic acid
SMILESCc1c(Br)c(O[Sb](=O)(O)O)c2ncccc2c1Br
InChIInChI=1S/C10H7Br2NO.2H2O.O.Sb/c1-5-7(11)6-3-2-4-13-9(6)10(14)8(5)12;;;;/h2-4,14H,1H3;2*1H2;;/q;;;;+3/p-3
InChIKeyHHJLUXSDAYJYHA-UHFFFAOYSA-K
XLogP2.30
TPSA79.65 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500487.75
LogP ≤ 52.30
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze (5,7-dibromo-6-methylquinolin-8-yl)oxystibonic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (5,7-dibromo-6-methylquinolin-8-yl)oxystibonic acid?
The IUPAC name of (5,7-dibromo-6-methylquinolin-8-yl)oxystibonic acid (CID 20836064) is (5,7-dibromo-6-methylquinolin-8-yl)oxystibonic acid.
What is the SMILES notation for (5,7-dibromo-6-methylquinolin-8-yl)oxystibonic acid?
The canonical SMILES for (5,7-dibromo-6-methylquinolin-8-yl)oxystibonic acid is Cc1c(Br)c(O[Sb](=O)(O)O)c2ncccc2c1Br.
What is the InChIKey of (5,7-dibromo-6-methylquinolin-8-yl)oxystibonic acid?
The InChIKey is HHJLUXSDAYJYHA-UHFFFAOYSA-K. The full InChI is InChI=1S/C10H7Br2NO.2H2O.O.Sb/c1-5-7(11)6-3-2-4-13-9(6)10(14)8(5)12;;;;/h2-4,14H,1H3;2*1H2;;/q;;;;+3/p-3.
What are the key properties of (5,7-dibromo-6-methylquinolin-8-yl)oxystibonic acid?
(5,7-dibromo-6-methylquinolin-8-yl)oxystibonic acid has a molecular weight of 487.75 g/mol, XLogP of 2.30, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5,7-dibromo-6-methylquinolin-8-yl)oxystibonic acid is sourced from PubChem (CID 20836064), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).