C9H7BrN2O2 — CID 142818668
7-bromo-8-methoxy-6H-1,6-naphthyridin-5-one (PubChem CID 142818668) has the molecular formula C9H7BrN2O2 and a molecular weight of 255.07 g/mol. Its IUPAC name is 7-bromo-8-methoxy-6H-1,6-naphthyridin-5-one.
| Compound Name | 7-bromo-8-methoxy-6H-1,6-naphthyridin-5-one |
|---|---|
| PubChem CID | 142818668 |
| Molecular Formula | C9H7BrN2O2 |
| Molecular Weight | 255.07 g/mol |
| Exact Mass | 253.97 |
| IUPAC Name | 7-bromo-8-methoxy-6H-1,6-naphthyridin-5-one |
| SMILES | COc1c(Br)[nH]c(=O)c2cccnc12 |
| InChI | InChI=1S/C9H7BrN2O2/c1-14-7-6-5(3-2-4-11-6)9(13)12-8(7)10/h2-4H,1H3,(H,12,13) |
| InChIKey | HVONZJSLDAFAML-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.07 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|