8-benzhydryloxy-5-methoxyquinoline-6,7-dicarboxylic acid

C25H19NO6 — CID 150124520

IUPAC8-benzhydryloxy-5-methoxyquinoline-6,7-dicarboxylic acid
SMILESCOc1c(C(=O)O)c(C(=O)O)c(OC(c2ccccc2)c2ccccc2)c2ncccc12
InChIInChI=1S/C25H19NO6/c1-31-22-17-13-8-14-26-20(17)23(19(25(29)30)18(22)24(27)28)32-21(15-9-4-2-5-10-15)16-11-6-3-7-12-16/h2-14,21H,1H3,(H,27,28)(H,29,30)
InChIKeyDZYDCKNKRWLTKT-UHFFFAOYSA-N
MW429.43 g/mol
LogP4.81
Rot. Bonds7

About 8-benzhydryloxy-5-methoxyquinoline-6,7-dicarboxylic acid

8-benzhydryloxy-5-methoxyquinoline-6,7-dicarboxylic acid (PubChem CID 150124520) has the molecular formula C25H19NO6 and a molecular weight of 429.43 g/mol. Its IUPAC name is 8-benzhydryloxy-5-methoxyquinoline-6,7-dicarboxylic acid.

Molecular Properties

Compound Name8-benzhydryloxy-5-methoxyquinoline-6,7-dicarboxylic acid
PubChem CID150124520
Molecular FormulaC25H19NO6
Molecular Weight429.43 g/mol
Exact Mass429.12
IUPAC Name8-benzhydryloxy-5-methoxyquinoline-6,7-dicarboxylic acid
SMILESCOc1c(C(=O)O)c(C(=O)O)c(OC(c2ccccc2)c2ccccc2)c2ncccc12
InChIInChI=1S/C25H19NO6/c1-31-22-17-13-8-14-26-20(17)23(19(25(29)30)18(22)24(27)28)32-21(15-9-4-2-5-10-15)16-11-6-3-7-12-16/h2-14,21H,1H3,(H,27,28)(H,29,30)
InChIKeyDZYDCKNKRWLTKT-UHFFFAOYSA-N
XLogP4.81
TPSA105.95 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds7
Heavy Atoms32
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500429.43
LogP ≤ 54.81
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Analyze 8-benzhydryloxy-5-methoxyquinoline-6,7-dicarboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 8-benzhydryloxy-5-methoxyquinoline-6,7-dicarboxylic acid?
The IUPAC name of 8-benzhydryloxy-5-methoxyquinoline-6,7-dicarboxylic acid (CID 150124520) is 8-benzhydryloxy-5-methoxyquinoline-6,7-dicarboxylic acid.
What is the SMILES notation for 8-benzhydryloxy-5-methoxyquinoline-6,7-dicarboxylic acid?
The canonical SMILES for 8-benzhydryloxy-5-methoxyquinoline-6,7-dicarboxylic acid is COc1c(C(=O)O)c(C(=O)O)c(OC(c2ccccc2)c2ccccc2)c2ncccc12.
What is the InChIKey of 8-benzhydryloxy-5-methoxyquinoline-6,7-dicarboxylic acid?
The InChIKey is DZYDCKNKRWLTKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H19NO6/c1-31-22-17-13-8-14-26-20(17)23(19(25(29)30)18(22)24(27)28)32-21(15-9-4-2-5-10-15)16-11-6-3-7-12-16/h2-14,21H,1H3,(H,27,28)(H,29,30).
What are the key properties of 8-benzhydryloxy-5-methoxyquinoline-6,7-dicarboxylic acid?
8-benzhydryloxy-5-methoxyquinoline-6,7-dicarboxylic acid has a molecular weight of 429.43 g/mol, XLogP of 4.81, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 8-benzhydryloxy-5-methoxyquinoline-6,7-dicarboxylic acid is sourced from PubChem (CID 150124520), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).