C34H28FN3O4 — CID 58652689
9-benzhydryloxy-7-[(4-fluorophenyl)methyl]-N-methoxy-N-methyl-8-oxo-6H-pyrrolo[3,4-g]quinoline-5-carboxamide (PubChem CID 58652689) has the molecular formula C34H28FN3O4 and a molecular weight of 561.61 g/mol. Its IUPAC name is 9-benzhydryloxy-7-[(4-fluorophenyl)methyl]-N-methoxy-N-methyl-8-oxo-6H-pyrrolo[3,4-g]quinoline-5-carboxamide.
| Compound Name | 9-benzhydryloxy-7-[(4-fluorophenyl)methyl]-N-methoxy-N-methyl-8-oxo-6H-pyrrolo[3,4-g]quinoline-5-carboxamide |
|---|---|
| PubChem CID | 58652689 |
| Molecular Formula | C34H28FN3O4 |
| Molecular Weight | 561.61 g/mol |
| Exact Mass | 561.21 |
| IUPAC Name | 9-benzhydryloxy-7-[(4-fluorophenyl)methyl]-N-methoxy-N-methyl-8-oxo-6H-pyrrolo[3,4-g]quinoline-5-carboxamide |
| SMILES | CON(C)C(=O)c1c2c(c(OC(c3ccccc3)c3ccccc3)c3ncccc13)C(=O)N(Cc1ccc(F)cc1)C2 |
| InChI | InChI=1S/C34H28FN3O4/c1-37(41-2)33(39)28-26-14-9-19-36-30(26)32(42-31(23-10-5-3-6-11-23)24-12-7-4-8-13-24)29-27(28)21-38(34(29)40)20-22-15-17-25(35)18-16-22/h3-19,31H,20-21H2,1-2H3 |
| InChIKey | QDSRKMBZXJDABI-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 71.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.61 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|