C35H29FN4O5 — CID 143148988
[9-benzhydryloxy-7-[(4-fluorophenyl)methyl]-8-oxo-6H-pyrrolo[3,4-g]quinolin-5-yl] N-(2-formamidoethyl)carbamate (PubChem CID 143148988) has the molecular formula C35H29FN4O5 and a molecular weight of 604.64 g/mol. Its IUPAC name is [9-benzhydryloxy-7-[(4-fluorophenyl)methyl]-8-oxo-6H-pyrrolo[3,4-g]quinolin-5-yl] N-(2-formamidoethyl)carbamate.
| Compound Name | [9-benzhydryloxy-7-[(4-fluorophenyl)methyl]-8-oxo-6H-pyrrolo[3,4-g]quinolin-5-yl] N-(2-formamidoethyl)carbamate |
|---|---|
| PubChem CID | 143148988 |
| Molecular Formula | C35H29FN4O5 |
| Molecular Weight | 604.64 g/mol |
| Exact Mass | 604.21 |
| IUPAC Name | [9-benzhydryloxy-7-[(4-fluorophenyl)methyl]-8-oxo-6H-pyrrolo[3,4-g]quinolin-5-yl] N-(2-formamidoethyl)carbamate |
| SMILES | O=CNCCNC(=O)Oc1c2c(c(OC(c3ccccc3)c3ccccc3)c3ncccc13)C(=O)N(Cc1ccc(F)cc1)C2 |
| InChI | InChI=1S/C35H29FN4O5/c36-26-15-13-23(14-16-26)20-40-21-28-29(34(40)42)33(44-31(24-8-3-1-4-9-24)25-10-5-2-6-11-25)30-27(12-7-17-38-30)32(28)45-35(43)39-19-18-37-22-41/h1-17,22,31H,18-21H2,(H,37,41)(H,39,43) |
| InChIKey | QAZKSWIFSNWQFE-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 109.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.64 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|