C32H25FN3O2+ — CID 58836752
9-[cyclohexatrienyl(phenyl)methoxy]-7-[(4-fluorophenyl)methyl]-5-(methylamino)-6H-pyrrolo[3,4-g]quinolin-8-one (PubChem CID 58836752) has the molecular formula C32H25FN3O2+ and a molecular weight of 502.57 g/mol. Its IUPAC name is 9-[cyclohexatrienyl(phenyl)methoxy]-7-[(4-fluorophenyl)methyl]-5-(methylamino)-6H-pyrrolo[3,4-g]quinolin-8-one.
| Compound Name | 9-[cyclohexatrienyl(phenyl)methoxy]-7-[(4-fluorophenyl)methyl]-5-(methylamino)-6H-pyrrolo[3,4-g]quinolin-8-one |
|---|---|
| PubChem CID | 58836752 |
| Molecular Formula | C32H25FN3O2+ |
| Molecular Weight | 502.57 g/mol |
| Exact Mass | 502.19 |
| IUPAC Name | 9-[cyclohexatrienyl(phenyl)methoxy]-7-[(4-fluorophenyl)methyl]-5-(methylamino)-6H-pyrrolo[3,4-g]quinolin-8-one |
| SMILES | CNc1c2c(c(OC(C3=CC=[C+]C=C3)c3ccccc3)c3ncccc13)C(=O)N(Cc1ccc(F)cc1)C2 |
| InChI | InChI=1S/C32H25FN3O2/c1-34-28-25-13-8-18-35-29(25)31(38-30(22-9-4-2-5-10-22)23-11-6-3-7-12-23)27-26(28)20-36(32(27)37)19-21-14-16-24(33)17-15-21/h2,4-18,30,34H,19-20H2,1H3/q+1 |
| InChIKey | PWJPGCGITGJXDM-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.57 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|