C35H32FIN2O3S — CID 142886236
2-[[9-benzhydryloxy-7-[(4-fluorophenyl)methyl]-8-oxo-6H-pyrrolo[3,4-g]quinolin-5-yl]oxy]ethyl thiohypoiodite;ethane (PubChem CID 142886236) has the molecular formula C35H32FIN2O3S and a molecular weight of 706.62 g/mol. Its IUPAC name is 2-[[9-benzhydryloxy-7-[(4-fluorophenyl)methyl]-8-oxo-6H-pyrrolo[3,4-g]quinolin-5-yl]oxy]ethyl thiohypoiodite;ethane.
| Compound Name | 2-[[9-benzhydryloxy-7-[(4-fluorophenyl)methyl]-8-oxo-6H-pyrrolo[3,4-g]quinolin-5-yl]oxy]ethyl thiohypoiodite;ethane |
|---|---|
| PubChem CID | 142886236 |
| Molecular Formula | C35H32FIN2O3S |
| Molecular Weight | 706.62 g/mol |
| Exact Mass | 706.12 |
| IUPAC Name | 2-[[9-benzhydryloxy-7-[(4-fluorophenyl)methyl]-8-oxo-6H-pyrrolo[3,4-g]quinolin-5-yl]oxy]ethyl thiohypoiodite;ethane |
| SMILES | CC.O=C1c2c(c(OCCSI)c3cccnc3c2OC(c2ccccc2)c2ccccc2)CN1Cc1ccc(F)cc1 |
| InChI | InChI=1S/C33H26FIN2O3S.C2H6/c34-25-15-13-22(14-16-25)20-37-21-27-28(33(37)38)32(29-26(12-7-17-36-29)31(27)39-18-19-41-35)40-30(23-8-3-1-4-9-23)24-10-5-2-6-11-24;1-2/h1-17,30H,18-21H2;1-2H3 |
| InChIKey | HOWLGNTVTCLYNT-UHFFFAOYSA-N |
| XLogP | 9.19 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.62 |
| LogP ≤ 5 | 9.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|