C34H26F4N2O6S — CID 142885951
[9-benzhydryloxy-7-[(4-fluorophenyl)methyl]-6,8-dioxopyrrolo[3,4-g]quinolin-5-yl] trifluoromethanesulfonate;ethane (PubChem CID 142885951) has the molecular formula C34H26F4N2O6S and a molecular weight of 666.65 g/mol. Its IUPAC name is [9-benzhydryloxy-7-[(4-fluorophenyl)methyl]-6,8-dioxopyrrolo[3,4-g]quinolin-5-yl] trifluoromethanesulfonate;ethane.
| Compound Name | [9-benzhydryloxy-7-[(4-fluorophenyl)methyl]-6,8-dioxopyrrolo[3,4-g]quinolin-5-yl] trifluoromethanesulfonate;ethane |
|---|---|
| PubChem CID | 142885951 |
| Molecular Formula | C34H26F4N2O6S |
| Molecular Weight | 666.65 g/mol |
| Exact Mass | 666.14 |
| IUPAC Name | [9-benzhydryloxy-7-[(4-fluorophenyl)methyl]-6,8-dioxopyrrolo[3,4-g]quinolin-5-yl] trifluoromethanesulfonate;ethane |
| SMILES | CC.O=C1c2c(c(OC(c3ccccc3)c3ccccc3)c3ncccc3c2OS(=O)(=O)C(F)(F)F)C(=O)N1Cc1ccc(F)cc1 |
| InChI | InChI=1S/C32H20F4N2O6S.C2H6/c33-22-15-13-19(14-16-22)18-38-30(39)24-25(31(38)40)29(43-27(20-8-3-1-4-9-20)21-10-5-2-6-11-21)26-23(12-7-17-37-26)28(24)44-45(41,42)32(34,35)36;1-2/h1-17,27H,18H2;1-2H3 |
| InChIKey | LINPLYMTGPOAIN-UHFFFAOYSA-N |
| XLogP | 7.59 |
| TPSA | 102.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.65 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|