C46H44FN2O8P — CID 142886308
ethane;ethyl 2-[2-[9-benzhydryloxy-7-[(4-fluorophenyl)methyl]-6,8-dioxopyrrolo[3,4-g]quinolin-5-yl]oxyethyl-phenoxyphosphanyl]oxypropanoate (PubChem CID 142886308) has the molecular formula C46H44FN2O8P and a molecular weight of 802.84 g/mol. Its IUPAC name is ethane;ethyl 2-[2-[9-benzhydryloxy-7-[(4-fluorophenyl)methyl]-6,8-dioxopyrrolo[3,4-g]quinolin-5-yl]oxyethyl-phenoxyphosphanyl]oxypropanoate.
| Compound Name | ethane;ethyl 2-[2-[9-benzhydryloxy-7-[(4-fluorophenyl)methyl]-6,8-dioxopyrrolo[3,4-g]quinolin-5-yl]oxyethyl-phenoxyphosphanyl]oxypropanoate |
|---|---|
| PubChem CID | 142886308 |
| Molecular Formula | C46H44FN2O8P |
| Molecular Weight | 802.84 g/mol |
| Exact Mass | 802.28 |
| IUPAC Name | ethane;ethyl 2-[2-[9-benzhydryloxy-7-[(4-fluorophenyl)methyl]-6,8-dioxopyrrolo[3,4-g]quinolin-5-yl]oxyethyl-phenoxyphosphanyl]oxypropanoate |
| SMILES | CC.CCOC(=O)C(C)OP(CCOc1c2c(c(OC(c3ccccc3)c3ccccc3)c3ncccc13)C(=O)N(Cc1ccc(F)cc1)C2=O)Oc1ccccc1 |
| InChI | InChI=1S/C44H38FN2O8P.C2H6/c1-3-51-44(50)29(2)54-56(55-34-18-11-6-12-19-34)27-26-52-40-35-20-13-25-46-38(35)41(53-39(31-14-7-4-8-15-31)32-16-9-5-10-17-32)37-36(40)42(48)47(43(37)49)28-30-21-23-33(45)24-22-30;1-2/h4-25,29,39H,3,26-28H2,1-2H3;1-2H3 |
| InChIKey | KECNTLIKHFMVHQ-UHFFFAOYSA-N |
| XLogP | 10.10 |
| TPSA | 113.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 802.84 |
| LogP ≤ 5 | 10.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|