C25H26FN2O7P — CID 142886041
5-(diethoxyphosphanylmethoxy)-7-[(4-fluorophenyl)methyl]-9-(methoxymethoxy)pyrrolo[3,4-g]quinoline-6,8-dione (PubChem CID 142886041) has the molecular formula C25H26FN2O7P and a molecular weight of 516.46 g/mol. Its IUPAC name is 5-(diethoxyphosphanylmethoxy)-7-[(4-fluorophenyl)methyl]-9-(methoxymethoxy)pyrrolo[3,4-g]quinoline-6,8-dione.
| Compound Name | 5-(diethoxyphosphanylmethoxy)-7-[(4-fluorophenyl)methyl]-9-(methoxymethoxy)pyrrolo[3,4-g]quinoline-6,8-dione |
|---|---|
| PubChem CID | 142886041 |
| Molecular Formula | C25H26FN2O7P |
| Molecular Weight | 516.46 g/mol |
| Exact Mass | 516.15 |
| IUPAC Name | 5-(diethoxyphosphanylmethoxy)-7-[(4-fluorophenyl)methyl]-9-(methoxymethoxy)pyrrolo[3,4-g]quinoline-6,8-dione |
| SMILES | CCOP(COc1c2c(c(OCOC)c3ncccc13)C(=O)N(Cc1ccc(F)cc1)C2=O)OCC |
| InChI | InChI=1S/C25H26FN2O7P/c1-4-34-36(35-5-2)15-33-22-18-7-6-12-27-21(18)23(32-14-31-3)20-19(22)24(29)28(25(20)30)13-16-8-10-17(26)11-9-16/h6-12H,4-5,13-15H2,1-3H3 |
| InChIKey | HJGXIWRNWJTATJ-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 96.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.46 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|