C29H35FN2O3Si — CID 58928874
7-[(4-fluorophenyl)methyl]-5-methoxy-6-methylidene-9-tri(propan-2-yl)silyloxypyrrolo[3,4-g]quinolin-8-one (PubChem CID 58928874) has the molecular formula C29H35FN2O3Si and a molecular weight of 506.69 g/mol. Its IUPAC name is 7-[(4-fluorophenyl)methyl]-5-methoxy-6-methylidene-9-tri(propan-2-yl)silyloxypyrrolo[3,4-g]quinolin-8-one.
| Compound Name | 7-[(4-fluorophenyl)methyl]-5-methoxy-6-methylidene-9-tri(propan-2-yl)silyloxypyrrolo[3,4-g]quinolin-8-one |
|---|---|
| PubChem CID | 58928874 |
| Molecular Formula | C29H35FN2O3Si |
| Molecular Weight | 506.69 g/mol |
| Exact Mass | 506.24 |
| IUPAC Name | 7-[(4-fluorophenyl)methyl]-5-methoxy-6-methylidene-9-tri(propan-2-yl)silyloxypyrrolo[3,4-g]quinolin-8-one |
| SMILES | C=C1c2c(c(O[Si](C(C)C)(C(C)C)C(C)C)c3ncccc3c2OC)C(=O)N1Cc1ccc(F)cc1 |
| InChI | InChI=1S/C29H35FN2O3Si/c1-17(2)36(18(3)4,19(5)6)35-28-25-24(27(34-8)23-10-9-15-31-26(23)28)20(7)32(29(25)33)16-21-11-13-22(30)14-12-21/h9-15,17-19H,7,16H2,1-6,8H3 |
| InChIKey | FPOUKEZFVPDCAP-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.69 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|