C26H29FN2O3Si — CID 58712617
5-ethyl-7-[(4-fluorophenyl)methyl]-9-triethylsilyloxypyrrolo[3,4-g]quinoline-6,8-dione (PubChem CID 58712617) has the molecular formula C26H29FN2O3Si and a molecular weight of 464.61 g/mol. Its IUPAC name is 5-ethyl-7-[(4-fluorophenyl)methyl]-9-triethylsilyloxypyrrolo[3,4-g]quinoline-6,8-dione.
| Compound Name | 5-ethyl-7-[(4-fluorophenyl)methyl]-9-triethylsilyloxypyrrolo[3,4-g]quinoline-6,8-dione |
|---|---|
| PubChem CID | 58712617 |
| Molecular Formula | C26H29FN2O3Si |
| Molecular Weight | 464.61 g/mol |
| Exact Mass | 464.19 |
| IUPAC Name | 5-ethyl-7-[(4-fluorophenyl)methyl]-9-triethylsilyloxypyrrolo[3,4-g]quinoline-6,8-dione |
| SMILES | CCc1c2c(c(O[Si](CC)(CC)CC)c3ncccc13)C(=O)N(Cc1ccc(F)cc1)C2=O |
| InChI | InChI=1S/C26H29FN2O3Si/c1-5-19-20-10-9-15-28-23(20)24(32-33(6-2,7-3)8-4)22-21(19)25(30)29(26(22)31)16-17-11-13-18(27)14-12-17/h9-15H,5-8,16H2,1-4H3 |
| InChIKey | AGRXQKYRZMAVIP-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.61 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|