C19H16Br2N2O2 — CID 26011286
(2R)-2-(5,7-dibromoquinolin-8-yl)oxy-N,N-dimethyl-2-phenylacetamide (PubChem CID 26011286) has the molecular formula C19H16Br2N2O2 and a molecular weight of 464.16 g/mol. Its IUPAC name is (2R)-2-(5,7-dibromoquinolin-8-yl)oxy-N,N-dimethyl-2-phenylacetamide.
| Compound Name | (2R)-2-(5,7-dibromoquinolin-8-yl)oxy-N,N-dimethyl-2-phenylacetamide |
|---|---|
| PubChem CID | 26011286 |
| Molecular Formula | C19H16Br2N2O2 |
| Molecular Weight | 464.16 g/mol |
| Exact Mass | 461.96 |
| IUPAC Name | (2R)-2-(5,7-dibromoquinolin-8-yl)oxy-N,N-dimethyl-2-phenylacetamide |
| SMILES | CN(C)C(=O)[C@H](Oc1c(Br)cc(Br)c2cccnc12)c1ccccc1 |
| InChI | InChI=1S/C19H16Br2N2O2/c1-23(2)19(24)17(12-7-4-3-5-8-12)25-18-15(21)11-14(20)13-9-6-10-22-16(13)18/h3-11,17H,1-2H3/t17-/m1/s1 |
| InChIKey | GIYWUNAKKQZDGE-QGZVFWFLSA-N |
| XLogP | 4.97 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.16 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |