2-[3-(5,7-dibromoquinolin-8-yl)oxyazetidin-3-yl]acetic acid

C14H12Br2N2O3 — CID 107140830

IUPAC2-[3-(5,7-dibromoquinolin-8-yl)oxyazetidin-3-yl]acetic acid
SMILESO=C(O)CC1(Oc2c(Br)cc(Br)c3cccnc23)CNC1
InChIInChI=1S/C14H12Br2N2O3/c15-9-4-10(16)13(12-8(9)2-1-3-18-12)21-14(5-11(19)20)6-17-7-14/h1-4,17H,5-7H2,(H,19,20)
InChIKeyNMTVLMOCQVVIDP-UHFFFAOYSA-N
MW416.07 g/mol
LogP2.96
Rot. Bonds4

About 2-[3-(5,7-dibromoquinolin-8-yl)oxyazetidin-3-yl]acetic acid

2-[3-(5,7-dibromoquinolin-8-yl)oxyazetidin-3-yl]acetic acid (PubChem CID 107140830) has the molecular formula C14H12Br2N2O3 and a molecular weight of 416.07 g/mol. Its IUPAC name is 2-[3-(5,7-dibromoquinolin-8-yl)oxyazetidin-3-yl]acetic acid.

Molecular Properties

Compound Name2-[3-(5,7-dibromoquinolin-8-yl)oxyazetidin-3-yl]acetic acid
PubChem CID107140830
Molecular FormulaC14H12Br2N2O3
Molecular Weight416.07 g/mol
Exact Mass413.92
IUPAC Name2-[3-(5,7-dibromoquinolin-8-yl)oxyazetidin-3-yl]acetic acid
SMILESO=C(O)CC1(Oc2c(Br)cc(Br)c3cccnc23)CNC1
InChIInChI=1S/C14H12Br2N2O3/c15-9-4-10(16)13(12-8(9)2-1-3-18-12)21-14(5-11(19)20)6-17-7-14/h1-4,17H,5-7H2,(H,19,20)
InChIKeyNMTVLMOCQVVIDP-UHFFFAOYSA-N
XLogP2.96
TPSA71.45 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500416.07
LogP ≤ 52.96
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 2-[3-(5,7-dibromoquinolin-8-yl)oxyazetidin-3-yl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[3-(5,7-dibromoquinolin-8-yl)oxyazetidin-3-yl]acetic acid?
The IUPAC name of 2-[3-(5,7-dibromoquinolin-8-yl)oxyazetidin-3-yl]acetic acid (CID 107140830) is 2-[3-(5,7-dibromoquinolin-8-yl)oxyazetidin-3-yl]acetic acid.
What is the SMILES notation for 2-[3-(5,7-dibromoquinolin-8-yl)oxyazetidin-3-yl]acetic acid?
The canonical SMILES for 2-[3-(5,7-dibromoquinolin-8-yl)oxyazetidin-3-yl]acetic acid is O=C(O)CC1(Oc2c(Br)cc(Br)c3cccnc23)CNC1.
What is the InChIKey of 2-[3-(5,7-dibromoquinolin-8-yl)oxyazetidin-3-yl]acetic acid?
The InChIKey is NMTVLMOCQVVIDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12Br2N2O3/c15-9-4-10(16)13(12-8(9)2-1-3-18-12)21-14(5-11(19)20)6-17-7-14/h1-4,17H,5-7H2,(H,19,20).
What are the key properties of 2-[3-(5,7-dibromoquinolin-8-yl)oxyazetidin-3-yl]acetic acid?
2-[3-(5,7-dibromoquinolin-8-yl)oxyazetidin-3-yl]acetic acid has a molecular weight of 416.07 g/mol, XLogP of 2.96, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(5,7-dibromoquinolin-8-yl)oxyazetidin-3-yl]acetic acid is sourced from PubChem (CID 107140830), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).