C11H7Br2F2N3O2 — CID 63569614
2-(5,7-dibromoquinolin-8-yl)oxy-2,2-difluoroacetohydrazide (PubChem CID 63569614) has the molecular formula C11H7Br2F2N3O2 and a molecular weight of 411.00 g/mol. Its IUPAC name is 2-(5,7-dibromoquinolin-8-yl)oxy-2,2-difluoroacetohydrazide.
| Compound Name | 2-(5,7-dibromoquinolin-8-yl)oxy-2,2-difluoroacetohydrazide |
|---|---|
| PubChem CID | 63569614 |
| Molecular Formula | C11H7Br2F2N3O2 |
| Molecular Weight | 411.00 g/mol |
| Exact Mass | 408.89 |
| IUPAC Name | 2-(5,7-dibromoquinolin-8-yl)oxy-2,2-difluoroacetohydrazide |
| SMILES | NNC(=O)C(F)(F)Oc1c(Br)cc(Br)c2cccnc12 |
| InChI | InChI=1S/C11H7Br2F2N3O2/c12-6-4-7(13)9(8-5(6)2-1-3-17-8)20-11(14,15)10(19)18-16/h1-4H,16H2,(H,18,19) |
| InChIKey | KIXZWWCGEAALKP-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.00 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|