C13H10N2O2 — CID 58424967
9-methoxy-6H-benzo[h][1,6]naphthyridin-5-one (PubChem CID 58424967) has the molecular formula C13H10N2O2 and a molecular weight of 226.24 g/mol. Its IUPAC name is 9-methoxy-6H-benzo[h][1,6]naphthyridin-5-one.
| Compound Name | 9-methoxy-6H-benzo[h][1,6]naphthyridin-5-one |
|---|---|
| PubChem CID | 58424967 |
| Molecular Formula | C13H10N2O2 |
| Molecular Weight | 226.24 g/mol |
| Exact Mass | 226.07 |
| IUPAC Name | 9-methoxy-6H-benzo[h][1,6]naphthyridin-5-one |
| SMILES | COc1ccc2[nH]c(=O)c3cccnc3c2c1 |
| InChI | InChI=1S/C13H10N2O2/c1-17-8-4-5-11-10(7-8)12-9(13(16)15-11)3-2-6-14-12/h2-7H,1H3,(H,15,16) |
| InChIKey | IFMRFCJWRIKSAB-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.24 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|